C13H24ClN3O — CID 79047030
1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(dimethylamino)-3-methylbutan-2-ol (PubChem CID 79047030) has the molecular formula C13H24ClN3O and a molecular weight of 273.81 g/mol. Its IUPAC name is 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(dimethylamino)-3-methylbutan-2-ol.
| Compound Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(dimethylamino)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 79047030 |
| Molecular Formula | C13H24ClN3O |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(dimethylamino)-3-methylbutan-2-ol |
| SMILES | CCc1nn(C)c(CC(O)C(C)(C)N(C)C)c1Cl |
| InChI | InChI=1S/C13H24ClN3O/c1-7-9-12(14)10(17(6)15-9)8-11(18)13(2,3)16(4)5/h11,18H,7-8H2,1-6H3 |
| InChIKey | YJRWWPXHACVPPC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |