C11H20N2OS — CID 82869244
1-butan-2-ylsulfanyl-3-(1-methylpyrazol-3-yl)propan-2-ol (PubChem CID 82869244) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 1-butan-2-ylsulfanyl-3-(1-methylpyrazol-3-yl)propan-2-ol.
| Compound Name | 1-butan-2-ylsulfanyl-3-(1-methylpyrazol-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 82869244 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-butan-2-ylsulfanyl-3-(1-methylpyrazol-3-yl)propan-2-ol |
| SMILES | CCC(C)SCC(O)Cc1ccn(C)n1 |
| InChI | InChI=1S/C11H20N2OS/c1-4-9(2)15-8-11(14)7-10-5-6-13(3)12-10/h5-6,9,11,14H,4,7-8H2,1-3H3 |
| InChIKey | IFWKAMDRLZPYKI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |