C13H28N4O — CID 105260141
[2-(1,4-dimethylpiperazin-2-yl)-1-(oxan-4-yl)ethyl]hydrazine (PubChem CID 105260141) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is [2-(1,4-dimethylpiperazin-2-yl)-1-(oxan-4-yl)ethyl]hydrazine.
| Compound Name | [2-(1,4-dimethylpiperazin-2-yl)-1-(oxan-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105260141 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | [2-(1,4-dimethylpiperazin-2-yl)-1-(oxan-4-yl)ethyl]hydrazine |
| SMILES | CN1CCN(C)C(CC(NN)C2CCOCC2)C1 |
| InChI | InChI=1S/C13H28N4O/c1-16-5-6-17(2)12(10-16)9-13(15-14)11-3-7-18-8-4-11/h11-13,15H,3-10,14H2,1-2H3 |
| InChIKey | BJFDLABUCXPDBE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|