C16H31N5 — CID 105241990
4-[3-(diethylamino)-3-ethyl-2-hydrazinylpentyl]pyridin-2-amine (PubChem CID 105241990) has the molecular formula C16H31N5 and a molecular weight of 293.46 g/mol. Its IUPAC name is 4-[3-(diethylamino)-3-ethyl-2-hydrazinylpentyl]pyridin-2-amine.
| Compound Name | 4-[3-(diethylamino)-3-ethyl-2-hydrazinylpentyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105241990 |
| Molecular Formula | C16H31N5 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | 4-[3-(diethylamino)-3-ethyl-2-hydrazinylpentyl]pyridin-2-amine |
| SMILES | CCN(CC)C(CC)(CC)C(Cc1ccnc(N)c1)NN |
| InChI | InChI=1S/C16H31N5/c1-5-16(6-2,21(7-3)8-4)14(20-18)11-13-9-10-19-15(17)12-13/h9-10,12,14,20H,5-8,11,18H2,1-4H3,(H2,17,19) |
| InChIKey | VNZZGEYJDBFWOO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|