C17H30IN3 — CID 105241983
N,N,3-triethyl-2-hydrazinyl-1-(4-iodophenyl)pentan-3-amine (PubChem CID 105241983) has the molecular formula C17H30IN3 and a molecular weight of 403.35 g/mol. Its IUPAC name is N,N,3-triethyl-2-hydrazinyl-1-(4-iodophenyl)pentan-3-amine.
| Compound Name | N,N,3-triethyl-2-hydrazinyl-1-(4-iodophenyl)pentan-3-amine |
|---|---|
| PubChem CID | 105241983 |
| Molecular Formula | C17H30IN3 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N,N,3-triethyl-2-hydrazinyl-1-(4-iodophenyl)pentan-3-amine |
| SMILES | CCN(CC)C(CC)(CC)C(Cc1ccc(I)cc1)NN |
| InChI | InChI=1S/C17H30IN3/c1-5-17(6-2,21(7-3)8-4)16(20-19)13-14-9-11-15(18)12-10-14/h9-12,16,20H,5-8,13,19H2,1-4H3 |
| InChIKey | QAYHEZGJMKCHDG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|