C10H12F3IN2 — CID 105205984
[4,4,4-trifluoro-1-(4-iodophenyl)butan-2-yl]hydrazine (PubChem CID 105205984) has the molecular formula C10H12F3IN2 and a molecular weight of 344.12 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(4-iodophenyl)butan-2-yl]hydrazine.
| Compound Name | [4,4,4-trifluoro-1-(4-iodophenyl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105205984 |
| Molecular Formula | C10H12F3IN2 |
| Molecular Weight | 344.12 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | [4,4,4-trifluoro-1-(4-iodophenyl)butan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccc(I)cc1)CC(F)(F)F |
| InChI | InChI=1S/C10H12F3IN2/c11-10(12,13)6-9(16-15)5-7-1-3-8(14)4-2-7/h1-4,9,16H,5-6,15H2 |
| InChIKey | DFAINJACESJCCZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|