C9H10F3IN2 — CID 105215678
[1,1,1-trifluoro-3-(4-iodophenyl)propan-2-yl]hydrazine (PubChem CID 105215678) has the molecular formula C9H10F3IN2 and a molecular weight of 330.09 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-(4-iodophenyl)propan-2-yl]hydrazine.
| Compound Name | [1,1,1-trifluoro-3-(4-iodophenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105215678 |
| Molecular Formula | C9H10F3IN2 |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | [1,1,1-trifluoro-3-(4-iodophenyl)propan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccc(I)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H10F3IN2/c10-9(11,12)8(15-14)5-6-1-3-7(13)4-2-6/h1-4,8,15H,5,14H2 |
| InChIKey | WNNVCKODMKBDED-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|