C9H11F2IN2 — CID 105265085
[1,1-difluoro-3-(4-iodophenyl)propan-2-yl]hydrazine (PubChem CID 105265085) has the molecular formula C9H11F2IN2 and a molecular weight of 312.10 g/mol. Its IUPAC name is [1,1-difluoro-3-(4-iodophenyl)propan-2-yl]hydrazine.
| Compound Name | [1,1-difluoro-3-(4-iodophenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105265085 |
| Molecular Formula | C9H11F2IN2 |
| Molecular Weight | 312.10 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | [1,1-difluoro-3-(4-iodophenyl)propan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccc(I)cc1)C(F)F |
| InChI | InChI=1S/C9H11F2IN2/c10-9(11)8(14-13)5-6-1-3-7(12)4-2-6/h1-4,8-9,14H,5,13H2 |
| InChIKey | MNDPMNPFCKFTNC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.10 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|