C11H17IN2O2 — CID 105246005
[3-(4-iodophenyl)-1,1-dimethoxypropan-2-yl]hydrazine (PubChem CID 105246005) has the molecular formula C11H17IN2O2 and a molecular weight of 336.17 g/mol. Its IUPAC name is [3-(4-iodophenyl)-1,1-dimethoxypropan-2-yl]hydrazine.
| Compound Name | [3-(4-iodophenyl)-1,1-dimethoxypropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105246005 |
| Molecular Formula | C11H17IN2O2 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | [3-(4-iodophenyl)-1,1-dimethoxypropan-2-yl]hydrazine |
| SMILES | COC(OC)C(Cc1ccc(I)cc1)NN |
| InChI | InChI=1S/C11H17IN2O2/c1-15-11(16-2)10(14-13)7-8-3-5-9(12)6-4-8/h3-6,10-11,14H,7,13H2,1-2H3 |
| InChIKey | UYAZGXQIPYDEGN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|