C10H12ClF3N2 — CID 105206174
[1-(4-chlorophenyl)-4,4,4-trifluorobutan-2-yl]hydrazine (PubChem CID 105206174) has the molecular formula C10H12ClF3N2 and a molecular weight of 252.67 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-4,4,4-trifluorobutan-2-yl]hydrazine.
| Compound Name | [1-(4-chlorophenyl)-4,4,4-trifluorobutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105206174 |
| Molecular Formula | C10H12ClF3N2 |
| Molecular Weight | 252.67 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | [1-(4-chlorophenyl)-4,4,4-trifluorobutan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)cc1)CC(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N2/c11-8-3-1-7(2-4-8)5-9(16-15)6-10(12,13)14/h1-4,9,16H,5-6,15H2 |
| InChIKey | OOQWZTHTOCBKJS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|