C10H11ClF4N2 — CID 107894856
[1-(4-chloro-3-fluorophenyl)-4,4,4-trifluorobutan-2-yl]hydrazine (PubChem CID 107894856) has the molecular formula C10H11ClF4N2 and a molecular weight of 270.66 g/mol. Its IUPAC name is [1-(4-chloro-3-fluorophenyl)-4,4,4-trifluorobutan-2-yl]hydrazine.
| Compound Name | [1-(4-chloro-3-fluorophenyl)-4,4,4-trifluorobutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 107894856 |
| Molecular Formula | C10H11ClF4N2 |
| Molecular Weight | 270.66 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | [1-(4-chloro-3-fluorophenyl)-4,4,4-trifluorobutan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)c(F)c1)CC(F)(F)F |
| InChI | InChI=1S/C10H11ClF4N2/c11-8-2-1-6(4-9(8)12)3-7(17-16)5-10(13,14)15/h1-2,4,7,17H,3,5,16H2 |
| InChIKey | PEJHYGGJBMQPMP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.66 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|