C10H10F3IO — CID 65478092
4,4,4-trifluoro-1-(4-iodophenyl)butan-2-ol (PubChem CID 65478092) has the molecular formula C10H10F3IO and a molecular weight of 330.09 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(4-iodophenyl)butan-2-ol.
| Compound Name | 4,4,4-trifluoro-1-(4-iodophenyl)butan-2-ol |
|---|---|
| PubChem CID | 65478092 |
| Molecular Formula | C10H10F3IO |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 4,4,4-trifluoro-1-(4-iodophenyl)butan-2-ol |
| SMILES | OC(Cc1ccc(I)cc1)CC(F)(F)F |
| InChI | InChI=1S/C10H10F3IO/c11-10(12,13)6-9(15)5-7-1-3-8(14)4-2-7/h1-4,9,15H,5-6H2 |
| InChIKey | NGBUJIZTNRYGKK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|