C15H13F3INO — CID 115911644
1-[2-amino-5-(trifluoromethyl)phenyl]-2-(4-iodophenyl)ethanol (PubChem CID 115911644) has the molecular formula C15H13F3INO and a molecular weight of 407.17 g/mol. Its IUPAC name is 1-[2-amino-5-(trifluoromethyl)phenyl]-2-(4-iodophenyl)ethanol.
| Compound Name | 1-[2-amino-5-(trifluoromethyl)phenyl]-2-(4-iodophenyl)ethanol |
|---|---|
| PubChem CID | 115911644 |
| Molecular Formula | C15H13F3INO |
| Molecular Weight | 407.17 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | 1-[2-amino-5-(trifluoromethyl)phenyl]-2-(4-iodophenyl)ethanol |
| SMILES | Nc1ccc(C(F)(F)F)cc1C(O)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C15H13F3INO/c16-15(17,18)10-3-6-13(20)12(8-10)14(21)7-9-1-4-11(19)5-2-9/h1-6,8,14,21H,7,20H2 |
| InChIKey | OGKXWNHKJITUDB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.17 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|