C15H14F3NO — CID 115911656
[2-amino-5-(trifluoromethyl)phenyl]-(4-methylphenyl)methanol (PubChem CID 115911656) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is [2-amino-5-(trifluoromethyl)phenyl]-(4-methylphenyl)methanol.
| Compound Name | [2-amino-5-(trifluoromethyl)phenyl]-(4-methylphenyl)methanol |
|---|---|
| PubChem CID | 115911656 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | [2-amino-5-(trifluoromethyl)phenyl]-(4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)c2cc(C(F)(F)F)ccc2N)cc1 |
| InChI | InChI=1S/C15H14F3NO/c1-9-2-4-10(5-3-9)14(20)12-8-11(15(16,17)18)6-7-13(12)19/h2-8,14,20H,19H2,1H3 |
| InChIKey | IPDZUVQXGCYQSC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|