C15H13F4NO — CID 115911628
1-[2-amino-5-(trifluoromethyl)phenyl]-2-(2-fluorophenyl)ethanol (PubChem CID 115911628) has the molecular formula C15H13F4NO and a molecular weight of 299.27 g/mol. Its IUPAC name is 1-[2-amino-5-(trifluoromethyl)phenyl]-2-(2-fluorophenyl)ethanol.
| Compound Name | 1-[2-amino-5-(trifluoromethyl)phenyl]-2-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 115911628 |
| Molecular Formula | C15H13F4NO |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[2-amino-5-(trifluoromethyl)phenyl]-2-(2-fluorophenyl)ethanol |
| SMILES | Nc1ccc(C(F)(F)F)cc1C(O)Cc1ccccc1F |
| InChI | InChI=1S/C15H13F4NO/c16-12-4-2-1-3-9(12)7-14(21)11-8-10(15(17,18)19)5-6-13(11)20/h1-6,8,14,21H,7,20H2 |
| InChIKey | RJCYTENPQOJNIL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|