C15H11F5O — CID 115351095
2-(2-fluorophenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanol (PubChem CID 115351095) has the molecular formula C15H11F5O and a molecular weight of 302.24 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-(2-fluorophenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 115351095 |
| Molecular Formula | C15H11F5O |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-(2-fluorophenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanol |
| SMILES | OC(Cc1ccccc1F)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F5O/c16-12-6-10(5-11(8-12)15(18,19)20)14(21)7-9-3-1-2-4-13(9)17/h1-6,8,14,21H,7H2 |
| InChIKey | IIORDJOGKRITQJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |