C15H11ClF4O — CID 114852064
2-(4-chloro-2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 114852064) has the molecular formula C15H11ClF4O and a molecular weight of 318.70 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 114852064 |
| Molecular Formula | C15H11ClF4O |
| Molecular Weight | 318.70 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | OC(Cc1ccc(Cl)cc1F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11ClF4O/c16-12-5-4-9(13(17)8-12)7-14(21)10-2-1-3-11(6-10)15(18,19)20/h1-6,8,14,21H,7H2 |
| InChIKey | CXHWSLZHFCXYFW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |