C11H14F3NO — CID 79746123
1-(5-ethyl-2-pyridinyl)-4,4,4-trifluorobutan-2-ol (PubChem CID 79746123) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-(5-ethyl-2-pyridinyl)-4,4,4-trifluorobutan-2-ol.
| Compound Name | 1-(5-ethyl-2-pyridinyl)-4,4,4-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 79746123 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-(5-ethyl-2-pyridinyl)-4,4,4-trifluorobutan-2-ol |
| SMILES | CCc1ccc(CC(O)CC(F)(F)F)nc1 |
| InChI | InChI=1S/C11H14F3NO/c1-2-8-3-4-9(15-7-8)5-10(16)6-11(12,13)14/h3-4,7,10,16H,2,5-6H2,1H3 |
| InChIKey | YHFNQJLRQLODNC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |