C12H16F3NO — CID 137411130
4,4,4-trifluoro-1-(5-propan-2-yl-2-pyridinyl)butan-2-ol (PubChem CID 137411130) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(5-propan-2-yl-2-pyridinyl)butan-2-ol.
| Compound Name | 4,4,4-trifluoro-1-(5-propan-2-yl-2-pyridinyl)butan-2-ol |
|---|---|
| PubChem CID | 137411130 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4,4,4-trifluoro-1-(5-propan-2-yl-2-pyridinyl)butan-2-ol |
| SMILES | CC(C)c1ccc(CC(O)CC(F)(F)F)nc1 |
| InChI | InChI=1S/C12H16F3NO/c1-8(2)9-3-4-10(16-7-9)5-11(17)6-12(13,14)15/h3-4,7-8,11,17H,5-6H2,1-2H3 |
| InChIKey | ONQJCKGOMNVQCF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |