C18H33N3 — CID 105242041
N,N,3-triethyl-2-hydrazinyl-1-(4-methylphenyl)pentan-3-amine (PubChem CID 105242041) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is N,N,3-triethyl-2-hydrazinyl-1-(4-methylphenyl)pentan-3-amine.
| Compound Name | N,N,3-triethyl-2-hydrazinyl-1-(4-methylphenyl)pentan-3-amine |
|---|---|
| PubChem CID | 105242041 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | N,N,3-triethyl-2-hydrazinyl-1-(4-methylphenyl)pentan-3-amine |
| SMILES | CCN(CC)C(CC)(CC)C(Cc1ccc(C)cc1)NN |
| InChI | InChI=1S/C18H33N3/c1-6-18(7-2,21(8-3)9-4)17(20-19)14-16-12-10-15(5)11-13-16/h10-13,17,20H,6-9,14,19H2,1-5H3 |
| InChIKey | KCVZNZDRFBXBJB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|