C18H33N3 — CID 105239157
N,N-diethyl-3-hydrazinyl-2-methyl-4-(4-propan-2-ylphenyl)butan-2-amine (PubChem CID 105239157) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinyl-2-methyl-4-(4-propan-2-ylphenyl)butan-2-amine.
| Compound Name | N,N-diethyl-3-hydrazinyl-2-methyl-4-(4-propan-2-ylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 105239157 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | N,N-diethyl-3-hydrazinyl-2-methyl-4-(4-propan-2-ylphenyl)butan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(Cc1ccc(C(C)C)cc1)NN |
| InChI | InChI=1S/C18H33N3/c1-7-21(8-2)18(5,6)17(20-19)13-15-9-11-16(12-10-15)14(3)4/h9-12,14,17,20H,7-8,13,19H2,1-6H3 |
| InChIKey | VYXHISVQZHQWSK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|