C13H27N5 — CID 105239262
N,N-diethyl-3-hydrazinyl-2-methyl-4-(1-methylpyrazol-3-yl)butan-2-amine (PubChem CID 105239262) has the molecular formula C13H27N5 and a molecular weight of 253.39 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinyl-2-methyl-4-(1-methylpyrazol-3-yl)butan-2-amine.
| Compound Name | N,N-diethyl-3-hydrazinyl-2-methyl-4-(1-methylpyrazol-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 105239262 |
| Molecular Formula | C13H27N5 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.23 |
| IUPAC Name | N,N-diethyl-3-hydrazinyl-2-methyl-4-(1-methylpyrazol-3-yl)butan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(Cc1ccn(C)n1)NN |
| InChI | InChI=1S/C13H27N5/c1-6-18(7-2)13(3,4)12(15-14)10-11-8-9-17(5)16-11/h8-9,12,15H,6-7,10,14H2,1-5H3 |
| InChIKey | GZMSQBQNIPEXIA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|