C12H16N4 — CID 105199243
[2-(1-methylpyrazol-3-yl)-1-phenylethyl]hydrazine (PubChem CID 105199243) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is [2-(1-methylpyrazol-3-yl)-1-phenylethyl]hydrazine.
| Compound Name | [2-(1-methylpyrazol-3-yl)-1-phenylethyl]hydrazine |
|---|---|
| PubChem CID | 105199243 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | [2-(1-methylpyrazol-3-yl)-1-phenylethyl]hydrazine |
| SMILES | Cn1ccc(CC(NN)c2ccccc2)n1 |
| InChI | InChI=1S/C12H16N4/c1-16-8-7-11(15-16)9-12(14-13)10-5-3-2-4-6-10/h2-8,12,14H,9,13H2,1H3 |
| InChIKey | CQAYJJZOGKBMSR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|