C11H18N6 — CID 102805146
[1-(1,3-dimethylpyrazol-4-yl)-2-(1-methylpyrazol-3-yl)ethyl]hydrazine (PubChem CID 102805146) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is [1-(1,3-dimethylpyrazol-4-yl)-2-(1-methylpyrazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(1,3-dimethylpyrazol-4-yl)-2-(1-methylpyrazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102805146 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | [1-(1,3-dimethylpyrazol-4-yl)-2-(1-methylpyrazol-3-yl)ethyl]hydrazine |
| SMILES | Cc1nn(C)cc1C(Cc1ccn(C)n1)NN |
| InChI | InChI=1S/C11H18N6/c1-8-10(7-17(3)14-8)11(13-12)6-9-4-5-16(2)15-9/h4-5,7,11,13H,6,12H2,1-3H3 |
| InChIKey | HVNGWAVDGQWGGF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|