C10H17N7 — CID 105230787
4-[1-hydrazinyl-2-(1-methylpyrazol-3-yl)ethyl]-1-methylpyrazol-5-amine (PubChem CID 105230787) has the molecular formula C10H17N7 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-[1-hydrazinyl-2-(1-methylpyrazol-3-yl)ethyl]-1-methylpyrazol-5-amine.
| Compound Name | 4-[1-hydrazinyl-2-(1-methylpyrazol-3-yl)ethyl]-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 105230787 |
| Molecular Formula | C10H17N7 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 4-[1-hydrazinyl-2-(1-methylpyrazol-3-yl)ethyl]-1-methylpyrazol-5-amine |
| SMILES | Cn1ccc(CC(NN)c2cnn(C)c2N)n1 |
| InChI | InChI=1S/C10H17N7/c1-16-4-3-7(15-16)5-9(14-12)8-6-13-17(2)10(8)11/h3-4,6,9,14H,5,11-12H2,1-2H3 |
| InChIKey | HDNWXXLDTPLWBA-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|