C10H14ClN5S — CID 105230944
4-[2-(5-chlorothiophen-2-yl)-1-hydrazinylethyl]-1-methylpyrazol-5-amine (PubChem CID 105230944) has the molecular formula C10H14ClN5S and a molecular weight of 271.78 g/mol. Its IUPAC name is 4-[2-(5-chlorothiophen-2-yl)-1-hydrazinylethyl]-1-methylpyrazol-5-amine.
| Compound Name | 4-[2-(5-chlorothiophen-2-yl)-1-hydrazinylethyl]-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 105230944 |
| Molecular Formula | C10H14ClN5S |
| Molecular Weight | 271.78 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-[2-(5-chlorothiophen-2-yl)-1-hydrazinylethyl]-1-methylpyrazol-5-amine |
| SMILES | Cn1ncc(C(Cc2ccc(Cl)s2)NN)c1N |
| InChI | InChI=1S/C10H14ClN5S/c1-16-10(12)7(5-14-16)8(15-13)4-6-2-3-9(11)17-6/h2-3,5,8,15H,4,12-13H2,1H3 |
| InChIKey | VYAKDHHOVKXQGW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.78 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|