C11H23N5 — CID 105230973
4-(3-ethyl-1-hydrazinylpentyl)-1-methylpyrazol-5-amine (PubChem CID 105230973) has the molecular formula C11H23N5 and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-(3-ethyl-1-hydrazinylpentyl)-1-methylpyrazol-5-amine.
| Compound Name | 4-(3-ethyl-1-hydrazinylpentyl)-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 105230973 |
| Molecular Formula | C11H23N5 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | 4-(3-ethyl-1-hydrazinylpentyl)-1-methylpyrazol-5-amine |
| SMILES | CCC(CC)CC(NN)c1cnn(C)c1N |
| InChI | InChI=1S/C11H23N5/c1-4-8(5-2)6-10(15-13)9-7-14-16(3)11(9)12/h7-8,10,15H,4-6,12-13H2,1-3H3 |
| InChIKey | LVVLCVUPIPIWBN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|