C15H21N5O — CID 105230739
4-[3-(2,3-dihydro-1-benzofuran-5-yl)-1-hydrazinylpropyl]-1-methylpyrazol-5-amine (PubChem CID 105230739) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-[3-(2,3-dihydro-1-benzofuran-5-yl)-1-hydrazinylpropyl]-1-methylpyrazol-5-amine.
| Compound Name | 4-[3-(2,3-dihydro-1-benzofuran-5-yl)-1-hydrazinylpropyl]-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 105230739 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-[3-(2,3-dihydro-1-benzofuran-5-yl)-1-hydrazinylpropyl]-1-methylpyrazol-5-amine |
| SMILES | Cn1ncc(C(CCc2ccc3c(c2)CCO3)NN)c1N |
| InChI | InChI=1S/C15H21N5O/c1-20-15(16)12(9-18-20)13(19-17)4-2-10-3-5-14-11(8-10)6-7-21-14/h3,5,8-9,13,19H,2,4,6-7,16-17H2,1H3 |
| InChIKey | XVQDXNUHNJAJKN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|