C14H20N2O — CID 105202382
[1-cyclopropyl-3-(2,3-dihydro-1-benzofuran-5-yl)propyl]hydrazine (PubChem CID 105202382) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is [1-cyclopropyl-3-(2,3-dihydro-1-benzofuran-5-yl)propyl]hydrazine.
| Compound Name | [1-cyclopropyl-3-(2,3-dihydro-1-benzofuran-5-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105202382 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | [1-cyclopropyl-3-(2,3-dihydro-1-benzofuran-5-yl)propyl]hydrazine |
| SMILES | NNC(CCc1ccc2c(c1)CCO2)C1CC1 |
| InChI | InChI=1S/C14H20N2O/c15-16-13(11-3-4-11)5-1-10-2-6-14-12(9-10)7-8-17-14/h2,6,9,11,13,16H,1,3-5,7-8,15H2 |
| InChIKey | WMSHLBYHCMGGMG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|