C12H16F2N2O — CID 105265014
[4-(2,3-dihydro-1-benzofuran-5-yl)-1,1-difluorobutan-2-yl]hydrazine (PubChem CID 105265014) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is [4-(2,3-dihydro-1-benzofuran-5-yl)-1,1-difluorobutan-2-yl]hydrazine.
| Compound Name | [4-(2,3-dihydro-1-benzofuran-5-yl)-1,1-difluorobutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105265014 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [4-(2,3-dihydro-1-benzofuran-5-yl)-1,1-difluorobutan-2-yl]hydrazine |
| SMILES | NNC(CCc1ccc2c(c1)CCO2)C(F)F |
| InChI | InChI=1S/C12H16F2N2O/c13-12(14)10(16-15)3-1-8-2-4-11-9(7-8)5-6-17-11/h2,4,7,10,12,16H,1,3,5-6,15H2 |
| InChIKey | NCBDRHNHDAHNES-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|