C13H20N2OS — CID 105213803
[4-(2,3-dihydro-1-benzofuran-5-yl)-1-methylsulfanylbutan-2-yl]hydrazine (PubChem CID 105213803) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is [4-(2,3-dihydro-1-benzofuran-5-yl)-1-methylsulfanylbutan-2-yl]hydrazine.
| Compound Name | [4-(2,3-dihydro-1-benzofuran-5-yl)-1-methylsulfanylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105213803 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | [4-(2,3-dihydro-1-benzofuran-5-yl)-1-methylsulfanylbutan-2-yl]hydrazine |
| SMILES | CSCC(CCc1ccc2c(c1)CCO2)NN |
| InChI | InChI=1S/C13H20N2OS/c1-17-9-12(15-14)4-2-10-3-5-13-11(8-10)6-7-16-13/h3,5,8,12,15H,2,4,6-7,9,14H2,1H3 |
| InChIKey | WYRNSKUWNNILHO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|