C13H26N4 — CID 105312810
[3,3-dimethyl-1-(1-propan-2-ylpyrazol-3-yl)pentan-2-yl]hydrazine (PubChem CID 105312810) has the molecular formula C13H26N4 and a molecular weight of 238.38 g/mol. Its IUPAC name is [3,3-dimethyl-1-(1-propan-2-ylpyrazol-3-yl)pentan-2-yl]hydrazine.
| Compound Name | [3,3-dimethyl-1-(1-propan-2-ylpyrazol-3-yl)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105312810 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | [3,3-dimethyl-1-(1-propan-2-ylpyrazol-3-yl)pentan-2-yl]hydrazine |
| SMILES | CCC(C)(C)C(Cc1ccn(C(C)C)n1)NN |
| InChI | InChI=1S/C13H26N4/c1-6-13(4,5)12(15-14)9-11-7-8-17(16-11)10(2)3/h7-8,10,12,15H,6,9,14H2,1-5H3 |
| InChIKey | SJNBULMERZOZDR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|