C10H9Cl2N3 — CID 82084834
5-[(3,4-dichlorophenyl)methyl]-1H-pyrazol-3-amine (PubChem CID 82084834) has the molecular formula C10H9Cl2N3 and a molecular weight of 242.11 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[(3,4-dichlorophenyl)methyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 82084834 |
| Molecular Formula | C10H9Cl2N3 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methyl]-1H-pyrazol-3-amine |
| SMILES | Nc1cc(Cc2ccc(Cl)c(Cl)c2)[nH]n1 |
| InChI | InChI=1S/C10H9Cl2N3/c11-8-2-1-6(4-9(8)12)3-7-5-10(13)15-14-7/h1-2,4-5H,3H2,(H3,13,14,15) |
| InChIKey | LHMAILHLFIJSOE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |