C11H10Cl2N4O — CID 149128882
3-amino-5-[(3,4-dichlorophenyl)methyl]-1H-pyrazole-4-carboxamide (PubChem CID 149128882) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is 3-amino-5-[(3,4-dichlorophenyl)methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 3-amino-5-[(3,4-dichlorophenyl)methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 149128882 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 3-amino-5-[(3,4-dichlorophenyl)methyl]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(N)n[nH]c1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N4O/c12-6-2-1-5(3-7(6)13)4-8-9(11(15)18)10(14)17-16-8/h1-3H,4H2,(H2,15,18)(H3,14,16,17) |
| InChIKey | RBURLFKNDKRVIS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |