C18H16ClN5O4 — CID 161419116
5-[(3-chlorophenyl)methyl]-3-[(4-hydroxy-3-nitrophenyl)methylamino]-1H-pyrazole-4-carboxamide (PubChem CID 161419116) has the molecular formula C18H16ClN5O4 and a molecular weight of 401.81 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-3-[(4-hydroxy-3-nitrophenyl)methylamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methyl]-3-[(4-hydroxy-3-nitrophenyl)methylamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 161419116 |
| Molecular Formula | C18H16ClN5O4 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-3-[(4-hydroxy-3-nitrophenyl)methylamino]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(NCc2ccc(O)c([N+](=O)[O-])c2)n[nH]c1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16ClN5O4/c19-12-3-1-2-10(6-12)7-13-16(17(20)26)18(23-22-13)21-9-11-4-5-15(25)14(8-11)24(27)28/h1-6,8,25H,7,9H2,(H2,20,26)(H2,21,22,23) |
| InChIKey | ADHOMSGINXDQJP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 147.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|