C18H19N5O4S — CID 159619556
3-[(4-hydroxyphenyl)methylamino]-5-[(4-sulfamoylphenyl)methyl]-1H-pyrazole-4-carboxamide (PubChem CID 159619556) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is 3-[(4-hydroxyphenyl)methylamino]-5-[(4-sulfamoylphenyl)methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 3-[(4-hydroxyphenyl)methylamino]-5-[(4-sulfamoylphenyl)methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 159619556 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-[(4-hydroxyphenyl)methylamino]-5-[(4-sulfamoylphenyl)methyl]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(NCc2ccc(O)cc2)n[nH]c1Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H19N5O4S/c19-17(25)16-15(9-11-3-7-14(8-4-11)28(20,26)27)22-23-18(16)21-10-12-1-5-13(24)6-2-12/h1-8,24H,9-10H2,(H2,19,25)(H2,20,26,27)(H2,21,22,23) |
| InChIKey | MNSHZOMZROSEMK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 164.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |