C10H12N6O3S — CID 86701915
5-amino-3-(4-sulfamoylanilino)-1H-pyrazole-4-carboxamide (PubChem CID 86701915) has the molecular formula C10H12N6O3S and a molecular weight of 296.31 g/mol. Its IUPAC name is 5-amino-3-(4-sulfamoylanilino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-(4-sulfamoylanilino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86701915 |
| Molecular Formula | C10H12N6O3S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 5-amino-3-(4-sulfamoylanilino)-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(Nc2ccc(S(N)(=O)=O)cc2)n[nH]c1N |
| InChI | InChI=1S/C10H12N6O3S/c11-8-7(9(12)17)10(16-15-8)14-5-1-3-6(4-2-5)20(13,18)19/h1-4H,(H2,12,17)(H2,13,18,19)(H4,11,14,15,16) |
| InChIKey | NPSOBYUAAHMXRV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 169.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |