C11H12N4O3S2 — CID 141008632
4-[(5-acetyl-4-amino-1,3-thiazol-2-yl)amino]benzenesulfonamide (PubChem CID 141008632) has the molecular formula C11H12N4O3S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 4-[(5-acetyl-4-amino-1,3-thiazol-2-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(5-acetyl-4-amino-1,3-thiazol-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 141008632 |
| Molecular Formula | C11H12N4O3S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-[(5-acetyl-4-amino-1,3-thiazol-2-yl)amino]benzenesulfonamide |
| SMILES | CC(=O)c1sc(Nc2ccc(S(N)(=O)=O)cc2)nc1N |
| InChI | InChI=1S/C11H12N4O3S2/c1-6(16)9-10(12)15-11(19-9)14-7-2-4-8(5-3-7)20(13,17)18/h2-5H,12H2,1H3,(H,14,15)(H2,13,17,18) |
| InChIKey | MBIFPMPGFZBZGN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |