C14H13N3O2S2 — CID 79126584
4-[(6-methyl-1,3-benzothiazol-2-yl)amino]benzenesulfonamide (PubChem CID 79126584) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-[(6-methyl-1,3-benzothiazol-2-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(6-methyl-1,3-benzothiazol-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 79126584 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-[(6-methyl-1,3-benzothiazol-2-yl)amino]benzenesulfonamide |
| SMILES | Cc1ccc2nc(Nc3ccc(S(N)(=O)=O)cc3)sc2c1 |
| InChI | InChI=1S/C14H13N3O2S2/c1-9-2-7-12-13(8-9)20-14(17-12)16-10-3-5-11(6-4-10)21(15,18)19/h2-8H,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | GDYZKGJEVIOYSF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |