C17H17N3O5S3 — CID 16805736
3-(4-methylphenyl)sulfonyl-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 16805736) has the molecular formula C17H17N3O5S3 and a molecular weight of 439.54 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-(4-methylphenyl)sulfonyl-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 16805736 |
| Molecular Formula | C17H17N3O5S3 |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)Nc2nc3ccc(S(N)(=O)=O)cc3s2)cc1 |
| InChI | InChI=1S/C17H17N3O5S3/c1-11-2-4-12(5-3-11)27(22,23)9-8-16(21)20-17-19-14-7-6-13(28(18,24)25)10-15(14)26-17/h2-7,10H,8-9H2,1H3,(H2,18,24,25)(H,19,20,21) |
| InChIKey | SLFGCJRWADMCJZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |