C23H26ClN5O2 — CID 158402934
5-[[4-(4-chloropiperidin-1-yl)phenyl]methyl]-3-[(4-hydroxyphenyl)methylamino]-1H-pyrazole-4-carboxamide (PubChem CID 158402934) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is 5-[[4-(4-chloropiperidin-1-yl)phenyl]methyl]-3-[(4-hydroxyphenyl)methylamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[[4-(4-chloropiperidin-1-yl)phenyl]methyl]-3-[(4-hydroxyphenyl)methylamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 158402934 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 5-[[4-(4-chloropiperidin-1-yl)phenyl]methyl]-3-[(4-hydroxyphenyl)methylamino]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(NCc2ccc(O)cc2)n[nH]c1Cc1ccc(N2CCC(Cl)CC2)cc1 |
| InChI | InChI=1S/C23H26ClN5O2/c24-17-9-11-29(12-10-17)18-5-1-15(2-6-18)13-20-21(22(25)31)23(28-27-20)26-14-16-3-7-19(30)8-4-16/h1-8,17,30H,9-14H2,(H2,25,31)(H2,26,27,28) |
| InChIKey | GYIBZUGJBLNQPJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|