C25H31N5O2 — CID 153252608
3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-5-[(4-piperidin-1-ylphenyl)methyl]-1H-pyrazole-4-carboxamide (PubChem CID 153252608) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-5-[(4-piperidin-1-ylphenyl)methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-5-[(4-piperidin-1-ylphenyl)methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 153252608 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-5-[(4-piperidin-1-ylphenyl)methyl]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(CNc2n[nH]c(Cc3ccc(N4CCCCC4)cc3)c2C(N)=O)cc(C)c1O |
| InChI | InChI=1S/C25H31N5O2/c1-16-12-19(13-17(2)23(16)31)15-27-25-22(24(26)32)21(28-29-25)14-18-6-8-20(9-7-18)30-10-4-3-5-11-30/h6-9,12-13,31H,3-5,10-11,14-15H2,1-2H3,(H2,26,32)(H2,27,28,29) |
| InChIKey | WTQDBWVHPSNOEE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|