C28H38N6O — CID 160863638
5-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide (PubChem CID 160863638) has the molecular formula C28H38N6O and a molecular weight of 474.65 g/mol. Its IUPAC name is 5-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 160863638 |
| Molecular Formula | C28H38N6O |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | 5-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(CNc2n[nH]c(Cc3ccc(N4CCN(C(C)C)CC4)cc3)c2C(N)=O)cc(C)c1C |
| InChI | InChI=1S/C28H38N6O/c1-18(2)33-10-12-34(13-11-33)24-8-6-22(7-9-24)16-25-26(27(29)35)28(32-31-25)30-17-23-14-19(3)21(5)20(4)15-23/h6-9,14-15,18H,10-13,16-17H2,1-5H3,(H2,29,35)(H2,30,31,32) |
| InChIKey | YINYSMQSHPCUCB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|