C28H31N7O — CID 158698645
3-[2-(4-methylphenyl)ethyl]-5-[[4-(4-pyrimidin-2-ylpiperazin-1-yl)phenyl]methyl]-1H-pyrazole-4-carboxamide (PubChem CID 158698645) has the molecular formula C28H31N7O and a molecular weight of 481.60 g/mol. Its IUPAC name is 3-[2-(4-methylphenyl)ethyl]-5-[[4-(4-pyrimidin-2-ylpiperazin-1-yl)phenyl]methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 3-[2-(4-methylphenyl)ethyl]-5-[[4-(4-pyrimidin-2-ylpiperazin-1-yl)phenyl]methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 158698645 |
| Molecular Formula | C28H31N7O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 3-[2-(4-methylphenyl)ethyl]-5-[[4-(4-pyrimidin-2-ylpiperazin-1-yl)phenyl]methyl]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1ccc(CCc2n[nH]c(Cc3ccc(N4CCN(c5ncccn5)CC4)cc3)c2C(N)=O)cc1 |
| InChI | InChI=1S/C28H31N7O/c1-20-3-5-21(6-4-20)9-12-24-26(27(29)36)25(33-32-24)19-22-7-10-23(11-8-22)34-15-17-35(18-16-34)28-30-13-2-14-31-28/h2-8,10-11,13-14H,9,12,15-19H2,1H3,(H2,29,36)(H,32,33) |
| InChIKey | XJYFWWXBTUICPE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|