C16H14N4O4S — CID 67683758
4-pyridin-4-yl-5-[(4-sulfamoylphenyl)methyl]-1H-pyrazole-3-carboxylic acid (PubChem CID 67683758) has the molecular formula C16H14N4O4S and a molecular weight of 358.38 g/mol. Its IUPAC name is 4-pyridin-4-yl-5-[(4-sulfamoylphenyl)methyl]-1H-pyrazole-3-carboxylic acid.
| Compound Name | 4-pyridin-4-yl-5-[(4-sulfamoylphenyl)methyl]-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 67683758 |
| Molecular Formula | C16H14N4O4S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-pyridin-4-yl-5-[(4-sulfamoylphenyl)methyl]-1H-pyrazole-3-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(Cc2[nH]nc(C(=O)O)c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C16H14N4O4S/c17-25(23,24)12-3-1-10(2-4-12)9-13-14(11-5-7-18-8-6-11)15(16(21)22)20-19-13/h1-8H,9H2,(H,19,20)(H,21,22)(H2,17,23,24) |
| InChIKey | BSLOKTHUJYQXIQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |