C8H7N3O4S — CID 119086499
5-sulfamoyl-1H-indazole-3-carboxylic acid (PubChem CID 119086499) has the molecular formula C8H7N3O4S and a molecular weight of 241.23 g/mol. Its IUPAC name is 5-sulfamoyl-1H-indazole-3-carboxylic acid.
| Compound Name | 5-sulfamoyl-1H-indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 119086499 |
| Molecular Formula | C8H7N3O4S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 5-sulfamoyl-1H-indazole-3-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc2[nH]nc(C(=O)O)c2c1 |
| InChI | InChI=1S/C8H7N3O4S/c9-16(14,15)4-1-2-6-5(3-4)7(8(12)13)11-10-6/h1-3H,(H,10,11)(H,12,13)(H2,9,14,15) |
| InChIKey | VLXOVQLYZQNSMS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |