C9H8N2O4S — CID 66925507
6-sulfamoyl-1H-indole-2-carboxylic acid (PubChem CID 66925507) has the molecular formula C9H8N2O4S and a molecular weight of 240.24 g/mol. Its IUPAC name is 6-sulfamoyl-1H-indole-2-carboxylic acid.
| Compound Name | 6-sulfamoyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 66925507 |
| Molecular Formula | C9H8N2O4S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 6-sulfamoyl-1H-indole-2-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc2cc(C(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C9H8N2O4S/c10-16(14,15)6-2-1-5-3-8(9(12)13)11-7(5)4-6/h1-4,11H,(H,12,13)(H2,10,14,15) |
| InChIKey | MKKJFDLVVVHHCK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |