C17H13N3O3S — CID 142239743
2-(2-oxo-1H-quinolin-3-yl)-1H-indole-6-sulfonamide (PubChem CID 142239743) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 2-(2-oxo-1H-quinolin-3-yl)-1H-indole-6-sulfonamide.
| Compound Name | 2-(2-oxo-1H-quinolin-3-yl)-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 142239743 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-(2-oxo-1H-quinolin-3-yl)-1H-indole-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2cc(-c3cc4ccccc4[nH]c3=O)[nH]c2c1 |
| InChI | InChI=1S/C17H13N3O3S/c18-24(22,23)12-6-5-11-8-16(19-15(11)9-12)13-7-10-3-1-2-4-14(10)20-17(13)21/h1-9,19H,(H,20,21)(H2,18,22,23) |
| InChIKey | XAJNOTRUYBYRQG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |