C18H14N2O2 — CID 174398264
3-[5-(hydroxymethyl)-1H-indol-2-yl]-1H-quinolin-2-one (PubChem CID 174398264) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-[5-(hydroxymethyl)-1H-indol-2-yl]-1H-quinolin-2-one.
| Compound Name | 3-[5-(hydroxymethyl)-1H-indol-2-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 174398264 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-[5-(hydroxymethyl)-1H-indol-2-yl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1-c1cc2cc(CO)ccc2[nH]1 |
| InChI | InChI=1S/C18H14N2O2/c21-10-11-5-6-16-13(7-11)9-17(19-16)14-8-12-3-1-2-4-15(12)20-18(14)22/h1-9,19,21H,10H2,(H,20,22) |
| InChIKey | CBWWTXVPFHWHLP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |