C22H22N4O — CID 22668304
3-[5-[(3-aminopyrrolidin-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one (PubChem CID 22668304) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 3-[5-[(3-aminopyrrolidin-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one.
| Compound Name | 3-[5-[(3-aminopyrrolidin-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 22668304 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-[5-[(3-aminopyrrolidin-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one |
| SMILES | NC1CCN(Cc2ccc3[nH]c(-c4cc5ccccc5[nH]c4=O)cc3c2)C1 |
| InChI | InChI=1S/C22H22N4O/c23-17-7-8-26(13-17)12-14-5-6-20-16(9-14)11-21(24-20)18-10-15-3-1-2-4-19(15)25-22(18)27/h1-6,9-11,17,24H,7-8,12-13,23H2,(H,25,27) |
| InChIKey | BKTSJPDIBUUXGO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |